CymitQuimica logo

CAS 89985-53-5

:

2-(1-aminoethyl)phenol

Description:
2-(1-Aminoethyl)phenol, also known by its CAS number 89985-53-5, is an organic compound characterized by the presence of both an amino group and a phenolic hydroxyl group. This compound features a phenol ring substituted with an aminoethyl group at the ortho position, which influences its chemical reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in water due to the presence of the hydroxyl group, while also being soluble in organic solvents. The amino group can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H11NO
InChI:InChI=1/C8H11NO/c1-6(9)7-4-2-3-5-8(7)10/h2-6,10H,9H2,1H3
SMILES:CC(c1ccccc1O)N
Synonyms:
  • 2-(1-Amino-ethyl)-phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.