CymitQuimica logo

CAS 899896-01-6

:

5-(3-Pyridinylamino)-4-thiazolecarboxylic acid

Description:
5-(3-Pyridinylamino)-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. The presence of the thiazole ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The pyridinylamino group can enhance solubility in polar solvents and may influence the compound's interaction with biological targets. Additionally, the carboxylic acid functional group is likely to impart acidic properties, allowing for protonation and deprotonation under different pH conditions. Such characteristics make this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 899896-01-6, serves as a unique identifier for regulatory and research purposes, facilitating the study and application of this compound in various scientific fields.
Formula:C9H7N3O2S
InChI:InChI=1S/C9H7N3O2S/c13-9(14)7-8(15-5-11-7)12-6-2-1-3-10-4-6/h1-5,12H,(H,13,14)
InChI key:InChIKey=AFDCHQIMPVZSJN-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)N=CS1)C=2C=CC=NC2
Synonyms:
  • 5-(3-Pyridinylamino)-4-thiazolecarboxylic acid
  • 5-[(Pyridin-3-yl)amino]thiazole-4-carboxylic acid
  • 4-Thiazolecarboxylic acid, 5-(3-pyridinylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.