CymitQuimica logo

CAS 899900-53-9

:

1-Formyl-D-proline

Description:
1-Formyl-D-proline is an amino acid derivative characterized by the presence of a formyl group (-CHO) attached to the nitrogen-containing proline structure. This compound is a chiral molecule, existing in the D-configuration, which influences its biological activity and interactions. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the formyl group introduces reactivity, making it a potential intermediate in organic synthesis and a useful building block in peptide synthesis. Additionally, 1-Formyl-D-proline may exhibit specific biological activities, including potential roles in metabolic pathways or as a precursor in the synthesis of more complex molecules. Its unique structure allows it to participate in various chemical reactions, including condensation and reduction reactions, which are significant in both synthetic and biological contexts. As with many amino acid derivatives, its stability and reactivity can be influenced by pH and temperature, making it essential to consider these factors in practical applications.
Formula:C6H9NO3
InChI:InChI=1S/C6H9NO3/c8-4-7-3-1-2-5(7)6(9)10/h4-5H,1-3H2,(H,9,10)/t5-/m1/s1
InChI key:InChIKey=DHDRGOURKDLAOT-RXMQYKEDSA-N
SMILES:C(=O)N1[C@@H](C(O)=O)CCC1
Synonyms:
  • (2R)-1-Formylpyrrolidine-2-carboxylic acid
  • 1-Formyl-D-proline
  • D-Proline, 1-formyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.