CymitQuimica logo

CAS 89991-52-6

:

9,10-Anthracenedione,1-amino-5,8-dihydroxy-4-[[2-[(2-hydroxyethyl)amino]ethyl]amino]-

Description:
9,10-Anthracenedione, 1-amino-5,8-dihydroxy-4-[[2-[(2-hydroxyethyl)amino]ethyl]amino]- is a complex organic compound characterized by its anthraquinone structure, which consists of three fused benzene rings. This compound features multiple functional groups, including amino and hydroxy groups, which contribute to its solubility and reactivity. The presence of the amino groups suggests potential for forming hydrogen bonds and participating in various chemical reactions, making it useful in biological and pharmaceutical applications. The hydroxy groups enhance its polarity, allowing for interactions with biological molecules. This compound may exhibit properties such as antioxidant activity or potential use in dye applications due to its conjugated system. Additionally, its structure may allow for interactions with cellular components, indicating possible roles in drug development or as a biochemical probe. However, specific biological activities, toxicity, and environmental impact would require further investigation to fully understand its implications in practical applications.
Formula:C18H19N3O5
InChI:InChI=1S/C18H19N3O5/c19-9-1-2-10(21-6-5-20-7-8-22)14-13(9)17(25)15-11(23)3-4-12(24)16(15)18(14)26/h1-4,20-24H,5-8,19H2
InChI key:NBSLQRRHRCDIHJ-UHFFFAOYSA-N
SMILES:C1=CC(=C2C(=C1N)C(=O)C3=C(C=CC(=C3C2=O)O)O)NCCNCCO
Found 6 products.