CAS 90-40-4
:3-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
Description:
3-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid, with the CAS number 90-40-4, is an organic compound characterized by its naphthalene structure, which is substituted with amino and hydroxy groups as well as sulfonic acid groups. This compound typically appears as a solid, often in a crystalline form, and is soluble in water due to the presence of the sulfonic acid groups, which enhance its polarity. It is known for its application as a dye intermediate and in the synthesis of various organic compounds. The presence of both amino and hydroxy functional groups contributes to its reactivity, allowing it to participate in various chemical reactions, including coupling reactions in dye chemistry. Additionally, the sulfonic acid groups impart acidic properties, making it useful in various industrial applications. Safety data indicates that, like many sulfonic acids, it should be handled with care to avoid skin and eye irritation. Overall, this compound plays a significant role in organic synthesis and dye manufacturing processes.
Formula:C10H9NO7S2
InChI:InChI=1S/C10H9NO7S2/c11-8-4-7-5(2-10(8)20(16,17)18)1-6(3-9(7)12)19(13,14)15/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18)
InChI key:InChIKey=VNWVMZDJPMCAKD-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(S(=O)(=O)O)C(N)=C2)C=C(S(=O)(=O)O)C1
Synonyms:- 7-Amino-1-naphthol-3,6-disulfonic acid
- 1-Naphthol-3,6-disulfonic acid, 7-amino-
- 6-Amino-4-naphthol-2,7-disulfonic acid
- 2,7-Naphthalenedisulfonic acid, 3-amino-5-hydroxy-
- 3-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
