CAS 90-53-9
:(2,3-dimethoxyphenyl)acetic acid
Description:
(2,3-Dimethoxyphenyl)acetic acid, with the CAS number 90-53-9, is an organic compound characterized by its aromatic structure and the presence of two methoxy groups attached to a phenyl ring. This compound features an acetic acid functional group, which contributes to its acidic properties. The methoxy groups enhance the compound's solubility in organic solvents and can influence its reactivity and biological activity. Typically, (2,3-dimethoxyphenyl)acetic acid exhibits moderate polarity due to the presence of both hydrophobic (aromatic and methoxy) and hydrophilic (carboxylic acid) components. It may be used in various applications, including pharmaceuticals and organic synthesis, where its unique structure can serve as a building block or a precursor for more complex molecules. Additionally, the compound's potential biological activities, such as anti-inflammatory or analgesic effects, may be of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic acids, to ensure safety and stability.
Formula:C10H12O4
InChI:InChI=1/C10H12O4/c1-13-8-5-3-4-7(6-9(11)12)10(8)14-2/h3-5H,6H2,1-2H3,(H,11,12)
SMILES:COc1cccc(CC(=O)O)c1OC
Synonyms:- Benzeneacetic acid, 2,3-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Dimethoxyphenylacetic Acid
CAS:Formula:C10H12O4Purity:97%Color and Shape:SolidMolecular weight:196.19992,3-Dimethoxyphenylacetic acid
CAS:2,3-Dimethoxyphenylacetic acidPurity:96%Color and Shape:SolidMolecular weight:196.20g/mol2,3-Dimethoxyphenylacetic acid
CAS:Formula:C10H12O4Purity:97%Color and Shape:SolidMolecular weight:196.2022,3-Dimethoxyphenylacetic acid
CAS:2,3-Dimethoxyphenylacetic acid is an amino acid derivative that is used as a precursor for the synthesis of drugs. It is a natural product that can be found in plants and animals. This compound has been synthesized by introducing a halide to the olefination of naphthoic acid with 2-methoxybenzaldehyde. The synthetic route has been modified to produce 2,3-dimethoxyphenylacetic acid from phenylacetic acid in order to avoid inefficiencies such as photochemical decomposition.Formula:C10H12O4Purity:Min. 95%Molecular weight:196.2 g/mol




