
CAS 90-85-7
:Benzylephedrine
Description:
Benzylephedrine, with the CAS number 90-85-7, is a sympathomimetic amine that acts primarily as a stimulant and bronchodilator. It is structurally related to ephedrine and is characterized by its ability to stimulate the central nervous system and increase heart rate. This compound is typically used in medical applications for its decongestant properties, helping to relieve nasal congestion by constricting blood vessels in the nasal passages. Benzylephedrine is also known for its potential to enhance athletic performance, although this use is often scrutinized in competitive sports due to its stimulant effects. The substance is usually encountered in its hydrochloride salt form, which is more soluble in water. In terms of safety, like other sympathomimetics, it can cause side effects such as increased blood pressure, anxiety, and insomnia, particularly when misused or taken in high doses. Proper handling and dosage are essential to minimize adverse effects and ensure therapeutic efficacy.
Formula:C17H21NO
InChI:InChI=1S/C17H21NO/c1-14(17(19)16-11-7-4-8-12-16)18(2)13-15-9-5-3-6-10-15/h3-12,14,17,19H,13H2,1-2H3
InChI key:InChIKey=KLNGFIBGXXNTLD-UHFFFAOYSA-N
SMILES:C(C(N(CC1=CC=CC=C1)C)C)(O)C2=CC=CC=C2
Synonyms:- α-[1-[Methyl(phenylmethyl)amino]ethyl]benzenemethanol
- α-[1-(Benzylmethylamino)ethyl]benzyl alcohol
- Benzyl alcohol, α-[1-(benzylmethylamino)ethyl]-
- Ephedrine, N-benzyl-
- Benzenemethanol, α-[1-[methyl(phenylmethyl)amino]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.