CymitQuimica logo

CAS 90000-31-0

:

2-piperidin-4-ylethanamine dihydrochloride

Description:
2-Piperidin-4-ylethanamine dihydrochloride, also known as a piperidine derivative, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound typically exhibits properties associated with amines, such as basicity and the ability to form salts, which is evident in its dihydrochloride form. The presence of the dihydrochloride indicates that the compound is a salt formed by the reaction of the amine with hydrochloric acid, enhancing its solubility in water. This substance may be utilized in various applications, including pharmaceutical research, due to its potential biological activity. Its structure allows for interactions with biological targets, making it of interest in medicinal chemistry. As with many amines, it may exhibit a range of physical properties, including a specific melting point, boiling point, and solubility profile, which can vary based on the purity and specific conditions of the compound. Safety data should be consulted for handling and usage, as amines can be irritants or toxic in certain concentrations.
Formula:C7H18Cl2N2
InChI:InChI=1/C7H16N2.2ClH/c8-4-1-7-2-5-9-6-3-7;;/h7,9H,1-6,8H2;2*1H
InChI key:FEZGICLENNVUHQ-UHFFFAOYSA-N
SMILES:C(CN)C1CCNCC1.Cl.Cl
Synonyms:
  • 2-(Piperidin-4-yl)ethanamine dihydrochloride
  • 4-Piperidineethanamine, Hydrochloride (1:2)
Found 3 products.