CymitQuimica logo

CAS 90000-71-8

:

5,6-dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxamide

Description:
5,6-Dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxamide is a heterocyclic organic compound characterized by its pyrazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 5 and 6 positions, contributing to its unique chemical properties and potential biological activity. The presence of a carbonyl group (3-oxo) and a carboxamide functional group (2-carboxamide) enhances its reactivity and solubility in polar solvents. The dihydropyrazine moiety indicates that it exists in a reduced form, which may influence its stability and reactivity. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its CAS number, 90000-71-8, is a unique identifier that facilitates its identification in chemical databases. Overall, 5,6-dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxamide is a compound with potential applications in medicinal chemistry, although specific studies on its properties and applications may be limited.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c1-3-4(2)10-7(12)5(9-3)6(8)11/h1-2H3,(H2,8,11)(H,10,12)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.