CAS 900014-88-2

6,9-Dihydro-9-(2-nitrophenyl)-1,3-dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one

Description:

6,9-Dihydro-9-(2-nitrophenyl)-1,3-dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one is a complex organic compound characterized by its unique fused ring structure, which includes a quinoline moiety and a dioxole unit. This compound typically exhibits a range of chemical properties, including potential fluorescence due to its conjugated system, which may be useful in various applications such as organic electronics or as a fluorescent probe. The presence of the nitrophenyl group suggests that it may have electron-withdrawing characteristics, influencing its reactivity and solubility in different solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of developing new materials or pharmaceuticals.

Formula: C₁₈H₁₂N₂O₆

InChI: InChI=1S/C18H12N2O6/c21-18-17-12(7-24-18)19-11-6-15-14(25-8-26-15)5-10(11)16(17)9-3-1-2-4-13(9)20(22)23/h1-6,16,19H,7-8H2

InChI key: InChIKey=HQXKDBWLBLPDJV-UHFFFAOYSA-N

SMILES: O=C1C=2C(C=3C(NC2CO1)=CC4=C(C3)OCO4)C5=C(N(=O)=O)C=CC=C5

Synonyms:

• 6,9-Dihydro-9-(2-nitrophenyl)-1,3-dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one
• 1,3-Dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one, 6,9-dihydro-9-(2-nitrophenyl)-