CAS 900015-00-1
:4-Amino-2,3-dihydro-2-[2-(2-pyridinyl)ethyl]-1H-isoindol-1-one
Description:
4-Amino-2,3-dihydro-2-[2-(2-pyridinyl)ethyl]-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a fused bicyclic system. This compound contains an amino group, contributing to its potential as a biological active molecule. The presence of a pyridine ring indicates that it may exhibit aromatic properties and participate in various chemical interactions, such as hydrogen bonding and coordination with metal ions. The ethyl side chain linked to the pyridine enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular structure suggests it could interact with various biological targets, making it a candidate for further research in drug discovery. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions under which it is studied.
Formula:C15H15N3O
InChI:InChI=1S/C15H15N3O/c16-14-6-3-5-12-13(14)10-18(15(12)19)9-7-11-4-1-2-8-17-11/h1-6,8H,7,9-10,16H2
InChI key:InChIKey=YYOBPOZEENXUKD-UHFFFAOYSA-N
SMILES:NC1=C2C(C(=O)N(CCC3=CC=CC=N3)C2)=CC=C1
Synonyms:- 4-Amino-2,3-dihydro-2-[2-(2-pyridinyl)ethyl]-1H-isoindol-1-one
- 1H-Isoindol-1-one, 4-amino-2,3-dihydro-2-[2-(2-pyridinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Amino-2-[2-(pyridin-2-yl)ethyl]-2,3-dihydro-1H-isoindol-1-one
CAS:4-Amino-2-[2-(pyridin-2-yl)ethyl]-2,3-dihydro-1H-isoindol-1-onePurity:techMolecular weight:253.30g/mol
