CAS 900015-32-9

3-Methyl-1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]-1-butanone

Description:

3-Methyl-1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]-1-butanone is a synthetic organic compound characterized by its complex structure, which includes a butanone moiety and a pyrrole ring substituted with a trichloroacetyl group. This compound typically exhibits properties common to ketones, such as being a polar solvent with potential reactivity due to the presence of the carbonyl group. The trichloroacetyl substituent may impart additional reactivity and influence the compound's biological activity, potentially making it useful in medicinal chemistry or as an intermediate in organic synthesis. The presence of chlorine atoms suggests that it may have specific environmental and safety considerations, as chlorinated compounds can exhibit toxicity and persistence in the environment. Its molecular structure indicates potential applications in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research into its biological properties and reactivity. As with any chemical, proper handling and safety protocols should be observed due to potential hazards associated with its use.

Formula: C₁₁H₁₂Cl₃NO₂

InChI: InChI=1S/C11H12Cl3NO2/c1-6(2)3-9(16)7-4-8(15-5-7)10(17)11(12,13)14/h4-6,15H,3H2,1-2H3

InChI key: InChIKey=YOWAMYPWPOTPNB-UHFFFAOYSA-N

SMILES: C(C(Cl)(Cl)Cl)(=O)C1=CC(C(CC(C)C)=O)=CN1

Synonyms:

• 3-Methyl-1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]-1-butanone
• 1-Butanone, 3-methyl-1-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]-