CAS 900015-39-6

6(1H)-Pyridazinone, 3-chloro-1-[2-[[(4-chlorobenzoyl)oxy]imino]propyl]-4-(4-morpholinyl)-

Description:

6(1H)-Pyridazinone, 3-chloro-1-[2-[[(4-chlorobenzoyl)oxy]imino]propyl]-4-(4-morpholinyl)- is a synthetic organic compound characterized by its complex structure, which includes a pyridazinone core, a chloro substituent, and a morpholine group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate to high solubility in polar solvents and potential bioactivity due to its functional groups. The presence of the chloro and morpholine moieties may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Its CAS number, 900015-39-6, allows for easy identification in chemical databases. As with many synthetic compounds, safety and handling precautions should be observed, as the presence of halogens and other reactive groups may pose hazards. Overall, this compound represents a class of molecules that could be valuable in drug development or as research tools in various biochemical applications.

Formula: C₁₈H₁₈Cl₂N₄O₄

InChI: InChI=1S/C18H18Cl2N4O4/c1-12(22-28-18(26)13-2-4-14(19)5-3-13)11-24-16(25)10-15(17(20)21-24)23-6-8-27-9-7-23/h2-5,10H,6-9,11H2,1H3

InChI key: InChIKey=DPEWMNUYFDKJSK-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(=O)N(CC(=NOC(=O)C2=CC=C(Cl)C=C2)C)N1)N3CCOCC3

Synonyms:

• 6(1H)-Pyridazinone, 3-chloro-1-[2-[[(4-chlorobenzoyl)oxy]imino]propyl]-4-(4-morpholinyl)-
• 6-Chloro-2-(2-{[(4-chlorobenzoyl)oxy]imino}propyl)-5-morpholino-3(2H)-pyridazinone
• [1-(3-Chloro-4-morpholin-4-yl-6-oxopyridazin-1-yl)propan-2-ylideneamino] 4-chlorobenzoate