CAS 900015-65-8

2-(6-Chloroimidazo[1,2-a]pyridin-2-yl)benzoic acid

Description:

2-(6-Chloroimidazo[1,2-a]pyridin-2-yl)benzoic acid is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a benzoic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the imidazole ring, which is known for its role in various biochemical processes. The chlorine substituent on the imidazo ring can influence the compound's reactivity and solubility, potentially enhancing its pharmacological properties. As a benzoic acid derivative, it may also exhibit acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. The compound's unique structure may contribute to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Overall, 2-(6-Chloroimidazo[1,2-a]pyridin-2-yl)benzoic acid represents a class of compounds that may hold significance in both research and therapeutic contexts.

Formula: C₁₄H₉ClN₂O₂

InChI: InChI=1S/C14H9ClN2O2/c15-9-5-6-13-16-12(8-17(13)7-9)10-3-1-2-4-11(10)14(18)19/h1-8H,(H,18,19)

InChI key: InChIKey=BJVHZIZUAFJVJV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=2N=C3N(C2)C=C(Cl)C=C3)C=CC=C1

Synonyms:

• 2-(6-Chloroimidazo[1,2-a]pyridin-2-yl)benzoic acid
• Benzoic acid, 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)-

2-{6-Chloroimidazo[1,2-a]pyridin-2-yl}benzoic acid

CAS: 900015-65-8

2-{6-Chloroimidazo[1,2-a]pyridin-2-yl}benzoic acid

Purity: tech

Molecular weight: 272.69g/mol

Ref: 54-OR33182