
CAS 900019-12-7
:3-[2-[[2-(Phenylmethoxy)acetyl]amino]phenoxy]-2-thiophenecarboxylic acid
Description:
3-[2-[[2-(Phenylmethoxy)acetyl]amino]phenoxy]-2-thiophenecarboxylic acid is a complex organic compound characterized by its multi-functional structure, which includes a thiophene ring, an acetylamino group, and a phenylmethoxy moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of various functional groups that can interact with biological systems. The thiophene ring contributes to its aromatic character, while the carboxylic acid group may impart acidic properties, influencing its reactivity and solubility in aqueous environments. Additionally, the presence of the phenylmethoxy group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for various chemical reactions, including esterification and amide formation, which can be exploited in synthetic applications. Overall, this compound's unique combination of functional groups positions it as a candidate for further research in pharmacology and organic synthesis.
Formula:C20H17NO5S
InChI:InChI=1S/C20H17NO5S/c22-18(13-25-12-14-6-2-1-3-7-14)21-15-8-4-5-9-16(15)26-17-10-11-27-19(17)20(23)24/h1-11H,12-13H2,(H,21,22)(H,23,24)
InChI key:InChIKey=YHNDKKQIPDZMBD-UHFFFAOYSA-N
SMILES:O(C1=C(NC(COCC2=CC=CC=C2)=O)C=CC=C1)C3=C(C(O)=O)SC=C3
Synonyms:- 3-[2-[[2-(Phenylmethoxy)acetyl]amino]phenoxy]-2-thiophenecarboxylic acid
- 2-Thiophenecarboxylic acid, 3-[2-[[2-(phenylmethoxy)acetyl]amino]phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.