
CAS 900019-24-1
:2,3-Dihydro-2-[2-(4-morpholinyl)ethyl]-4-nitro-1H-isoindol-1-one
Description:
2,3-Dihydro-2-[2-(4-morpholinyl)ethyl]-4-nitro-1H-isoindol-1-one is a chemical compound characterized by its complex structure, which includes an isoindole core, a nitro group, and a morpholine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the nitro group suggests it may participate in redox reactions, while the morpholine ring can contribute to its pharmacological properties, potentially enhancing its ability to cross biological membranes. The compound's molecular structure indicates it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 900019-24-1, allows for precise identification and retrieval of information regarding its synthesis, safety data, and applications in research. Overall, this compound represents a unique scaffold that could be explored for various chemical and biological applications.
Formula:C14H17N3O4
InChI:InChI=1S/C14H17N3O4/c18-14-11-2-1-3-13(17(19)20)12(11)10-16(14)5-4-15-6-8-21-9-7-15/h1-3H,4-10H2
InChI key:InChIKey=KSSSHFXTTGDJNM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C(=O)N(CCN3CCOCC3)C2)=CC=C1
Synonyms:- 1H-Isoindol-1-one, 2,3-dihydro-2-[2-(4-morpholinyl)ethyl]-4-nitro-
- 2,3-Dihydro-2-[2-(4-morpholinyl)ethyl]-4-nitro-1H-isoindol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.