CAS 900019-35-4

3-Nitro-4-(4-thiomorpholinyl)benzoic acid hydrazide

Description:

3-Nitro-4-(4-thiomorpholinyl)benzoic acid hydrazide is a chemical compound characterized by its complex structure, which includes a nitro group, a benzoic acid moiety, and a hydrazide functional group. The presence of the thiomorpholine ring introduces unique properties, such as potential nucleophilicity and the ability to participate in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its hydrazide functionality can facilitate interactions with biological targets, potentially influencing its pharmacological profile. The nitro group may also contribute to the compound's reactivity and stability under certain conditions. Overall, the combination of these functional groups suggests that 3-Nitro-4-(4-thiomorpholinyl)benzoic acid hydrazide could serve as a versatile building block in organic synthesis or as a lead compound in the exploration of therapeutic agents. However, specific properties such as solubility, melting point, and reactivity would require empirical investigation to fully characterize its behavior in various environments.

Formula: C₁₁H₁₄N₄O₃S

InChI: InChI=1S/C11H14N4O3S/c12-13-11(16)8-1-2-9(10(7-8)15(17)18)14-3-5-19-6-4-14/h1-2,7H,3-6,12H2,(H,13,16)

InChI key: InChIKey=VLDLBNXYPFWQFF-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=CC(C(NN)=O)=C1)N2CCSCC2

Synonyms:

• Benzoic acid, 3-nitro-4-(4-thiomorpholinyl)-, hydrazide
• 3-Nitro-4-(4-thiomorpholinyl)benzoic acid hydrazide