CAS 900019-51-4
:α-[(2-Methoxyphenyl)methylene]-1-methyl-β-oxo-1H-pyrrole-2-propanenitrile
Description:
α-[(2-Methoxyphenyl)methylene]-1-methyl-β-oxo-1H-pyrrole-2-propanenitrile, with the CAS number 900019-51-4, is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring, a methoxyphenyl group, and a nitrile functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential stability and reactivity due to the presence of the electron-withdrawing nitrile group and the electron-donating methoxy group. It may display interesting biological activities, making it a subject of interest in medicinal chemistry. The presence of the β-oxo group suggests potential for tautomerism and reactivity in various chemical reactions, including nucleophilic additions. Additionally, its solubility and behavior in different solvents can vary, influenced by the functional groups present. Overall, this compound's unique structure may lead to diverse applications in pharmaceuticals or materials science, although specific applications would depend on further research and characterization.
Formula:C16H14N2O2
InChI:InChI=1S/C16H14N2O2/c1-18-9-5-7-14(18)16(19)13(11-17)10-12-6-3-4-8-15(12)20-2/h3-10H,1-2H3
InChI key:InChIKey=CHRMYODPABZDIF-UHFFFAOYSA-N
SMILES:C(=C(C(=O)C=1N(C)C=CC1)C#N)C2=C(OC)C=CC=C2
Synonyms:- 1H-Pyrrole-2-propanenitrile, α-[(2-methoxyphenyl)methylene]-1-methyl-β-oxo-
- α-[(2-Methoxyphenyl)methylene]-1-methyl-β-oxo-1H-pyrrole-2-propanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.