CymitQuimica logo

CAS 900019-69-4

:

3-Fluoro-α-[(3-methoxyphenyl)methylene]-4-(4-morpholinyl)-β-oxobenzenepropanenitrile

Description:
3-Fluoro-α-[(3-methoxyphenyl)methylene]-4-(4-morpholinyl)-β-oxobenzenepropanenitrile, with the CAS number 900019-69-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a fluorine atom, a methoxyphenyl group, and a morpholine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its functional groups, which may interact with biological targets. The presence of the nitrile group suggests potential reactivity and the ability to participate in nucleophilic addition reactions. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Its structural features may contribute to specific pharmacological activities, although detailed biological data would be necessary to elucidate its potential applications. Overall, this compound represents a class of molecules that may be explored for therapeutic uses, particularly in the development of novel pharmaceuticals.
Formula:C21H19FN2O3
InChI:InChI=1S/C21H19FN2O3/c1-26-18-4-2-3-15(12-18)11-17(14-23)21(25)16-5-6-20(19(22)13-16)24-7-9-27-10-8-24/h2-6,11-13H,7-10H2,1H3
InChI key:InChIKey=XXRJJYQPJUEAJM-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(C(=CC2=CC(OC)=CC=C2)C#N)=O)=C1)N3CCOCC3
Synonyms:
  • 3-Fluoro-α-[(3-methoxyphenyl)methylene]-4-(4-morpholinyl)-β-oxobenzenepropanenitrile
  • Benzenepropanenitrile, 3-fluoro-α-[(3-methoxyphenyl)methylene]-4-(4-morpholinyl)-β-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.