CAS 90002-36-1
:2-Ethylbenzeneboronic acid
Description:
2-Ethylbenzeneboronic acid, with the CAS number 90002-36-1, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 2-ethyl-substituted phenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents, such as ethanol and methanol, but has limited solubility in water. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. 2-Ethylbenzeneboronic acid can participate in Suzuki coupling reactions, which are valuable for constructing carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, its structural features may impart unique reactivity and selectivity in chemical reactions, making it a useful building block in the development of pharmaceuticals and agrochemicals. Proper handling and storage are essential due to the potential reactivity of boronic acids with moisture and other functional groups.
Formula:C8H11BO2
InChI:InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3
SMILES:CCc1ccccc1B(O)O
Synonyms:- 2-Ethylphenylboronic acid
- RNase A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Ethylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO2Purity:97.0 to 115.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:149.982-Ethylphenylboronic acid
CAS:Formula:C8H11BO2Purity:98%Color and Shape:SolidMolecular weight:149.98272-Ethylbenzeneboronic acid
CAS:2-Ethylbenzeneboronic acidFormula:C8H11BO2Purity:98%Color and Shape: white crystalline powderMolecular weight:149.98g/mol2-Ethylphenylboronic Acid pure, 95%
CAS:Formula:C2H5C6H4B(OH)2Purity:min 95%Color and Shape:White to almost white, Powder to crystalMolecular weight:149.98






