CAS 90004-07-2

8-Methylpyrido[2,3-d]pyridazin-5(6H)-one

Description:

8-Methylpyrido[2,3-d]pyridazin-5(6H)-one is a heterocyclic organic compound characterized by its fused pyridine and pyridazine rings. This compound features a methyl group at the 8-position of the pyridine ring and a carbonyl group at the 5-position of the pyridazine moiety, contributing to its unique chemical properties. It typically exhibits a solid state at room temperature and may be soluble in polar organic solvents, depending on its specific structure and substituents. The presence of nitrogen atoms in the ring structure can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry. The CAS number 90004-07-2 is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. Overall, 8-Methylpyrido[2,3-d]pyridazin-5(6H)-one represents a fascinating subject for further research in both synthetic and applied chemistry.

Formula: C₈H₇N₃O

InChI: InChI=1S/C8H7N3O/c1-5-7-6(3-2-4-9-7)8(12)11-10-5/h2-4H,1H3,(H,11,12)

InChI key: InChIKey=VEZILOJHPMLRMW-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(C)=NN1)=NC=CC2

Synonyms:

• Pyrido[2,3-d]pyridazin-5(6H)-one, 8-methyl-
• Pyrido[2,3-d]pyridazin-5-ol, 8-methyl-
• 8-Methylpyrido[2,3-d]pyridazin-5(6H)-one
• 8-methylpyrido[3,2-d]pyridazin-5-ol
• 8-Methyl-pyrido[2,3-d]pyridazin-5-ol

8-Methylpyrido[2,3-d]pyridazin-5(6H)-one

CAS: 90004-07-2

8-Methylpyrido[2,3-d]pyridazin-5(6H)-one is a heterocyclic compound used in the field of medicinal chemistry. This compound is synthesized through complex organic reactions involving pyridazine and pyridine derivatives. As a molecule, its primary mode of action involves interactions with specific biochemical pathways, potentially influencing enzymatic activity or receptor bindings, leading to modulation of biological activities.

Formula: C₈H₇N₃O

Purity: Min. 95%

Molecular weight: 161.16 g/mol

Ref: 3D-QDA00407