CAS 90004-83-4

2-bromo-3-chloro-4-hydroxy-5-methoxybenzaldehyde

Description:

2-Bromo-3-chloro-4-hydroxy-5-methoxybenzaldehyde is an organic compound characterized by its complex aromatic structure, which includes a benzaldehyde functional group. This compound features multiple halogen substituents (bromo and chloro) and functional groups such as a hydroxy (-OH) and a methoxy (-OCH3) group, contributing to its reactivity and potential applications in organic synthesis. The presence of these substituents can influence the compound's physical properties, such as solubility and boiling point, as well as its chemical reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its CAS number, 90004-83-4, allows for easy identification and reference in chemical databases. Overall, the unique combination of functional groups and substituents in 2-bromo-3-chloro-4-hydroxy-5-methoxybenzaldehyde makes it a valuable compound in both synthetic and medicinal chemistry.

Formula: C₈H₆BrClO₃

InChI: InChI=1/C8H6BrClO3/c1-13-5-2-4(3-11)6(9)7(10)8(5)12/h2-3,12H,1H3

SMILES: COc1cc(C=O)c(c(c1O)Cl)Br

2-bromo-3-chloro-4-hydroxy-5-methoxybenzaldehyde

CAS: 90004-83-4

Formula: C₈H₆BrClO₃

Purity: 95.0%

Molecular weight: 265.49

Ref: 10-F314983