CAS 90005-54-2
:2-amino-1-(3-hydroxyphenyl)ethanone
Description:
2-amino-1-(3-hydroxyphenyl)ethanone, also known by its CAS number 90005-54-2, is an organic compound characterized by the presence of an amino group and a ketone functional group, along with a phenolic hydroxyl group. This compound features a two-carbon ethyl chain connecting the amino group to a phenyl ring that has a hydroxyl group in the meta position. The presence of the amino group imparts basic properties, while the hydroxyl group contributes to its potential for hydrogen bonding and solubility in polar solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, which may affect its behavior in various chemical reactions. Overall, 2-amino-1-(3-hydroxyphenyl)ethanone is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H9NO2
InChI:InChI=1/C8H9NO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,10H,5,9H2
SMILES:c1cc(cc(c1)O)C(=O)CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.