CAS 90005-55-3
:3-Amino-2-hydroxyacetophenone hydrochloride
Description:
3-Amino-2-hydroxyacetophenone hydrochloride is an organic compound characterized by the presence of an amino group, a hydroxyl group, and an acetophenone moiety. It typically appears as a white to off-white crystalline powder and is soluble in water and alcohol, which facilitates its use in various applications. The compound exhibits both acidic and basic properties due to the presence of the hydroxyl and amino groups, respectively. It is often utilized in the synthesis of dyes, pharmaceuticals, and as a reagent in organic chemistry. The hydrochloride form indicates that the compound is in its salt form, which can enhance its stability and solubility. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as with any chemical, to ensure proper handling and usage. Overall, 3-Amino-2-hydroxyacetophenone hydrochloride is a versatile compound with significant relevance in both industrial and research settings.
Formula:C8H10ClNO2
InChI:InChI=1/C8H9NO2.ClH/c1-5(10)6-3-2-4-7(9)8(6)11;/h2-4,11H,9H2,1H3;1H
SMILES:CC(=O)c1cccc(c1O)N.Cl
Synonyms:- 1-(3-Amino-2-Hydroxyphenyl)Ethanone Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethanone, 1-(3-amino-2-hydroxyphenyl)-, hydrochloride
CAS:Formula:C8H10ClNO2Purity:98%Color and Shape:SolidMolecular weight:187.62353'-Amino-2'-hydroxyacetophenone hydrochloride
CAS:3'-Amino-2'-hydroxyacetophenone hydrochloridePurity:98%Molecular weight:187.62g/mol3'-Amino-2'-hydroxyacetophenone Hydrochloride
CAS:Controlled ProductApplications Reagent used to prepare Aminophenol derivatives.
Formula:C8H10ClNO2Color and Shape:NeatMolecular weight:187.623'-Amino-2'-hydroxyacetophenone HCl
CAS:3'-Amino-2'-hydroxyacetophenone HCl is a fine chemical that is used as a building block for complex compounds. It is also used as a research chemical and a reagent. 3'-Amino-2'-hydroxyacetophenone HCl is an intermediate in the synthesis of other chemicals, such as 1,1-dihydroxyanthraquinone. This chemical can be reacted with acetic acid to form acetophenone and 3-aminoacetanilide. CAS No. 90005-55-3Formula:C8H10ClNO2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:187.62 g/mol3′-Amino-2′-hydroxyacetophenone hydrochloride
CAS:Formula:C8H10ClNO2Purity:98%Molecular weight:187.62




