CAS 90006-89-6

3-Oxo-8-azabicyclo[3.2.1]octane-8-carbonitrile

Description:

3-Oxo-8-azabicyclo[3.2.1]octane-8-carbonitrile, with the CAS number 90006-89-6, is a bicyclic compound characterized by its unique structural framework that includes a nitrogen atom within a bicyclic system. This compound features a ketone functional group (the "3-oxo" part) and a nitrile group (the "8-carbonitrile" part), which contribute to its reactivity and potential applications in medicinal chemistry. The bicyclic structure provides rigidity, which can influence the compound's biological activity and interaction with biological targets. The presence of the azabicyclic framework suggests potential for use in drug development, particularly in the design of compounds that can interact with neurotransmitter systems. Additionally, the compound's properties, such as solubility, stability, and reactivity, would be influenced by the functional groups attached to the bicyclic core. Overall, 3-Oxo-8-azabicyclo[3.2.1]octane-8-carbonitrile represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation in the context of drug discovery and development.

Formula: C₈H₁₀N₂O

InChI: InChI=1S/C8H10N2O/c9-5-10-6-1-2-7(10)4-8(11)3-6/h6-7H,1-4H2

InChI key: InChIKey=ABNFNHUEWPDNCU-UHFFFAOYSA-N

SMILES: C(#N)N1C2CC(=O)CC1CC2

Synonyms:

• 8-Azabicyclo[3.2.1]octane-8-carbonitrile, 3-oxo-
• 8-Nortropanecarbonitrile, 3-oxo-
• 3-Oxo-8-azabicyclo[3.2.1]octane-8-carbonitrile

8-Azabicyclo[3.2.1]octane-8-carbonitrile, 3-oxo-

CAS: 90006-89-6

Formula: C₈H₁₀N₂O

Purity: 97%

Molecular weight: 150.1778

Ref: IN-DA01QRR0