CAS 90007-06-0

N'-hydroxy-2-phenoxyethanimidamide

Description:

N'-hydroxy-2-phenoxyethanimidamide, with the CAS number 90007-06-0, is a chemical compound characterized by its unique functional groups and structure. It features a hydroxylamine moiety, which is indicative of its potential reactivity and ability to participate in various chemical reactions, particularly in the formation of N-oxides. The presence of the phenoxy group suggests that it may exhibit aromatic properties, contributing to its stability and potential interactions with other aromatic compounds. This compound may also possess biological activity, as many derivatives of hydroxamic acids are known to act as enzyme inhibitors or have other pharmacological effects. Its solubility, stability, and reactivity can be influenced by the surrounding environment, including pH and temperature. While specific applications or uses may vary, compounds of this nature are often explored in medicinal chemistry and materials science for their unique properties and potential utility in various fields. Further studies would be necessary to fully elucidate its characteristics and applications.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1/C8H10N2O2/c9-8(10-11)6-12-7-4-2-1-3-5-7/h1-5,11H,6H2,(H2,9,10)

SMILES: c1ccc(cc1)OCC(=N)NO

Synonyms:

• (1Z)-N'-Hydroxy-2-phenoxyethanimidamide
• ethanimidamide, N'-hydroxy-2-phenoxy-, (1Z)-
• N-hydroxy-2-phenoxyethanimidamide

N'-Hydroxy-2-phenoxyethanimidamide

CAS: 90007-06-0

N'-Hydroxy-2-phenoxyethanimidamide

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 166.18g/mol

Ref: 54-OR72178

N-Hydroxy-2-phenoxy-acetamidine

CAS: 90007-06-0

Formula: C₈H₁₀N₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 166.18

Ref: 10-F522011

N'-Hydroxy-2-phenoxyethanimidamide

CAS: 90007-06-0

Versatile small molecule scaffold

Formula: C₈H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 166.18 g/mol

Ref: 3D-QDA00706