
CAS 90008-32-5
:3,5-Dimethyl-2,6-pyridinediamine
Description:
3,5-Dimethyl-2,6-pyridinediamine, with the CAS number 90008-32-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing nitrogen atoms. This compound features two amino groups (-NH2) located at the 2 and 6 positions of the pyridine ring, and two methyl groups (-CH3) at the 3 and 5 positions. These substituents influence its chemical reactivity and physical properties, such as solubility and boiling point. The presence of amino groups makes it a potential candidate for various applications, including as a building block in organic synthesis, in the production of dyes, or as a ligand in coordination chemistry. Additionally, the methyl groups can enhance the lipophilicity of the molecule, affecting its interaction with biological systems. Overall, 3,5-Dimethyl-2,6-pyridinediamine is a versatile compound with potential utility in both industrial and research settings.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-4-3-5(2)7(9)10-6(4)8/h3H,1-2H3,(H4,8,9,10)
InChI key:InChIKey=OMIAIHIVQFDRJK-UHFFFAOYSA-N
SMILES:CC1=C(N)N=C(N)C(C)=C1
Synonyms:- 3,5-Lutidine, 2,6-diamino-
- 3,5-Dimethyl-2,6-pyridinediamine
- 2,6-Pyridinediamine, 3,5-dimethyl-
- 3,5-Dimethylpyridine-2,6-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
