CAS 90008-43-8

6-ethyl-2-methylpyrimidin-4-amine

Description:

6-Ethyl-2-methylpyrimidin-4-amine is a chemical compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an ethyl group at the 6-position and a methyl group at the 2-position, along with an amino group at the 4-position, contributing to its basicity and potential reactivity. The presence of these substituents influences its physical and chemical properties, such as solubility, boiling point, and reactivity with other chemical species. Pyrimidine derivatives like this one are often studied for their biological activity, including potential applications in pharmaceuticals and agrochemicals. The compound's structure allows for various interactions, making it a candidate for further research in medicinal chemistry. Additionally, its CAS number, 90008-43-8, serves as a unique identifier for regulatory and safety information. Overall, 6-ethyl-2-methylpyrimidin-4-amine exemplifies the diverse chemistry of nitrogen-containing heterocycles.

Formula: C₇H₁₁N₃

InChI: InChI=1/C7H11N3/c1-3-6-4-7(8)10-5(2)9-6/h4H,3H2,1-2H3,(H2,8,9,10)

SMILES: CCc1cc(=N)[nH]c(C)n1

6-Ethyl-2-methylpyrimidin-4-amine

CAS: 90008-43-8

Formula: C₇H₁₁N₃

Molecular weight: 137.1823

Ref: IN-DA00H4I2

6-Ethyl-2-methylpyrimidin-4-amine

CAS: 90008-43-8

6-Ethyl-2-methylpyrimidin-4-amine

Purity: ≥95%

Molecular weight: 137.18g/mol

Ref: 54-OR302376

6-Ethyl-2-methylpyrimidin-4-amine

CAS: 90008-43-8

Formula: C₇H₁₁N₃

Purity: 95.0%

Molecular weight: 137.186

Ref: 10-F462532

6-Ethyl-2-methylpyrimidin-4-amine

CAS: 90008-43-8

Versatile small molecule scaffold

Formula: C₇H₁₁N₃

Purity: Min. 95%

Molecular weight: 137.18 g/mol

Ref: 3D-QDA00843