
CAS 90008-44-9
:5-Ethyl-N-methyl-2-pyrimidinamine
Description:
5-Ethyl-N-methyl-2-pyrimidinamine, with the CAS number 90008-44-9, is a chemical compound that belongs to the class of pyrimidine derivatives. Pyrimidines are six-membered heterocyclic compounds containing nitrogen atoms, and this particular compound features an ethyl group and a methyl group attached to the nitrogen atom of the pyrimidine ring. The presence of these alkyl groups can influence the compound's solubility, reactivity, and biological activity. Typically, pyrimidine derivatives are known for their roles in pharmaceuticals and agrochemicals, often exhibiting various biological activities such as antimicrobial or antiviral properties. The compound's structure suggests potential applications in medicinal chemistry, although specific biological activities and uses would depend on further empirical studies. Additionally, its physical properties, such as melting point, boiling point, and solubility, would be determined through experimental methods. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, affecting its interactions in biological systems.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-3-6-4-9-7(8-2)10-5-6/h4-5H,3H2,1-2H3,(H,8,9,10)
InChI key:InChIKey=HAUWYEXWTQWCCH-UHFFFAOYSA-N
SMILES:C(C)C=1C=NC(NC)=NC1
Synonyms:- Pyrimidine, 5-ethyl-2-(methylamino)-
- 5-Ethyl-N-methyl-2-pyrimidinamine
- 2-Pyrimidinamine, 5-ethyl-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.