CymitQuimica logo

CAS 90012-40-1

:

3-(4-methylphenyl)-1-phenyl-1H-pyrazol-5-amine

Description:
3-(4-Methylphenyl)-1-phenyl-1H-pyrazol-5-amine, with the CAS number 90012-40-1, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group and a para-methylphenyl group attached to the pyrazole structure, contributing to its aromatic character and potentially influencing its chemical reactivity and solubility. The presence of the amine functional group indicates that it can participate in hydrogen bonding, which may affect its interactions in biological systems or with other chemical entities. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where pyrazole derivatives are often explored for their biological activity. Additionally, the presence of substituents like the methyl and phenyl groups can enhance lipophilicity, impacting the compound's bioavailability and pharmacokinetics. Overall, this compound exemplifies the diversity of pyrazole derivatives in organic chemistry and their potential utility in various fields.
Formula:C16H15N3
InChI:InChI=1/C16H15N3/c1-12-7-9-13(10-8-12)15-11-16(17)19(18-15)14-5-3-2-4-6-14/h2-11H,17H2,1H3
SMILES:Cc1ccc(cc1)c1cc(N)n(c2ccccc2)n1
Synonyms:
  • 1H-Pyrazol-5-amine, 3-(4-methylphenyl)-1-phenyl-
  • 3-(4-Methylphenyl)-1-phenyl-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.