CAS 900175-19-1
:2-Bromo-1-(ethylsulfonyl)-4-nitrobenzene
Description:
2-Bromo-1-(ethylsulfonyl)-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom, a nitro group, and an ethylsulfonyl substituent. The presence of the bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in nucleophilic substitution reactions. The nitro group, known for its electron-withdrawing properties, can influence the compound's electronic characteristics and reactivity, making it a potential candidate for various chemical transformations. The ethylsulfonyl group contributes to the compound's solubility and polarity, affecting its interactions in different solvents. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in further chemical reactions. Safety considerations should be taken into account when handling this compound, as it may pose health risks associated with its bromine and nitro functionalities. Overall, 2-Bromo-1-(ethylsulfonyl)-4-nitrobenzene is a versatile compound with significant applications in chemical synthesis.
Formula:C8H8BrNO4S
InChI:InChI=1S/C8H8BrNO4S/c1-2-15(13,14)8-4-3-6(10(11)12)5-7(8)9/h3-5H,2H2,1H3
InChI key:InChIKey=IRRXRYZVBOHGKP-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C1=C(Br)C=C(N(=O)=O)C=C1
Synonyms:- 2-Bromo-1-(ethylsulfonyl)-4-nitrobenzene
- 2-Bromo-1-(ethanesulfonyl)-4-nitrobenzene
- Benzene, 2-bromo-1-(ethylsulfonyl)-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.