CymitQuimica logo

CAS 90019-56-0

:

Pyrazolo[1,5-a]pyrimidin-7-ol, 2-phenyl-

Description:
Pyrazolo[1,5-a]pyrimidin-7-ol, 2-phenyl- is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the hydroxyl group at the 7-position and the phenyl substituent at the 2-position enhances its potential for interactions with biological targets. Its molecular structure allows for various functionalization possibilities, which can influence its solubility, stability, and reactivity. Pyrazolo[1,5-a]pyrimidin-7-ol derivatives are often studied for their potential as pharmaceuticals, particularly in the fields of anti-inflammatory and anti-cancer research. Additionally, the compound's properties can be influenced by factors such as pH and solvent, which can affect its ionization state and overall behavior in biological systems. Overall, this compound represents a significant area of interest for researchers exploring novel therapeutic agents.
Formula:C12H9N3O
InChI:InChI=1S/C12H9N3O/c16-12-6-7-13-11-8-10(14-15(11)12)9-4-2-1-3-5-9/h1-8,16H
InChI key:InChIKey=WDKRYHPLUZKKHU-UHFFFAOYSA-N
SMILES:OC=1N2N=C(C=C2N=CC1)C3=CC=CC=C3
Synonyms:
  • Pyrazolo[1,5-a]pyrimidin-7-ol, 2-phenyl-
  • 2-Phenyl-Pyrazolo[1,5-a]pyrimidin-7-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.