CAS 9003-16-1
:Poly(fumaric acid)
Description:
Poly(fumaric acid), with the CAS number 9003-16-1, is a synthetic polymer derived from fumaric acid, a dicarboxylic acid. This polymer is characterized by its linear structure, which consists of repeating units of fumaric acid, contributing to its unique properties. Poly(fumaric acid) is known for its biodegradability, making it an attractive option for environmentally friendly applications. It exhibits good thermal stability and can be processed into various forms, including films and fibers. The polymer is soluble in polar solvents, which enhances its versatility in different formulations. Additionally, poly(fumaric acid) can undergo various chemical modifications to improve its functionality, such as enhancing its mechanical properties or introducing specific reactive groups for further applications. Its potential uses span across fields such as drug delivery, biodegradable packaging, and as a component in composite materials. Overall, poly(fumaric acid) represents a significant advancement in the development of sustainable materials in the chemical industry.
Formula:(C4H4O4)x
InChI:InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+
InChI key:InChIKey=VZCYOOQTPOCHFL-OWOJBTEDSA-N
SMILES:C(=C/C(O)=O)\C(O)=O
Synonyms:- 2-Butenedioic acid (2E)-, homopolymer
- 2-Butenedioic acid (E)-, homopolymer
- Poly(fumaric acid)
- Fumaric acid, polymers
- Fumaric acid polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
