CAS 90033-63-9

1-(2-Amino-5-butylphenyl)ethanone

Description:

1-(2-Amino-5-butylphenyl)ethanone, identified by its CAS number 90033-63-9, is an organic compound characterized by the presence of an ethanone functional group attached to a phenyl ring that has an amino group and a butyl substituent. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity due to the amino group and reactivity characteristic of carbonyl compounds. It may appear as a solid or liquid depending on its specific form and purity. The presence of the butyl group can influence its solubility and hydrophobic characteristics, making it more soluble in organic solvents than in water. Additionally, the amino group can participate in hydrogen bonding, affecting its interactions with other molecules. This compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₁₇NO

InChI: InChI=1S/C12H17NO/c1-3-4-5-10-6-7-12(13)11(8-10)9(2)14/h6-8H,3-5,13H2,1-2H3

InChI key: InChIKey=KRLNHJAILMWFLL-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC(CCCC)=CC=C1N

Synonyms:

• 1-(2-Amino-5-butylphenyl)ethanone
• Ethanone, 1-(2-amino-5-butylphenyl)-
• 1-(2-Amino-5-butylphenyl)ethan-1-one