
CAS 90050-61-6
:6-Bromo-4H-1,3-benzodioxin
Description:
6-Bromo-4H-1,3-benzodioxin is an organic compound characterized by its unique bicyclic structure, which consists of a benzene ring fused to a dioxin moiety. This compound features a bromine atom substituted at the 6-position of the benzodioxin framework, which can influence its reactivity and biological activity. Typically, compounds of this class may exhibit properties such as moderate to high lipophilicity, which can affect their solubility in organic solvents and their behavior in biological systems. The presence of the bromine substituent can also impart specific electronic properties, potentially enhancing or modifying the compound's reactivity in various chemical reactions. Additionally, 6-Bromo-4H-1,3-benzodioxin may be of interest in research contexts, particularly in studies related to medicinal chemistry, environmental chemistry, or materials science, due to its potential applications in synthesizing other chemical entities or as a precursor in organic synthesis. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C8H7BrO2
InChI:InChI=1S/C8H7BrO2/c9-7-1-2-8-6(3-7)4-10-5-11-8/h1-3H,4-5H2
InChI key:InChIKey=PGJVSIQVFQXHFL-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=CC1)OCOC2
Synonyms:- 6-Bromo-4H-1,3-benzodioxin
- 1,3-Benzodioxan, 6-bromo-
- 4H-1,3-Benzodioxin, 6-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.