CAS 900505-08-0
:1-(4-chloro-3-nitro-phenyl)cyclopropanamine
Description:
1-(4-Chloro-3-nitro-phenyl)cyclopropanamine is an organic compound characterized by its cyclopropane structure fused with an amine group and a substituted phenyl ring. The presence of a chloro group and a nitro group on the phenyl ring contributes to its chemical reactivity and potential biological activity. The chloro substituent typically enhances lipophilicity, while the nitro group can participate in various chemical reactions, including reduction to amines. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the cyclopropane moiety can impart unique steric and electronic properties, influencing the compound's interaction with biological targets. As with many nitrogen-containing compounds, it is essential to consider its safety profile, including toxicity and environmental impact, during handling and application in research. Overall, 1-(4-chloro-3-nitro-phenyl)cyclopropanamine represents a complex structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C9H9ClN2O2
InChI:InChI=1/C9H9ClN2O2/c10-7-2-1-6(9(11)3-4-9)5-8(7)12(13)14/h1-2,5H,3-4,11H2
Synonyms:- 1-(4-chloro-3-nitrophenyl)cyclopropanamine
- 1-(4-Chlor-3-nitrophenyl)cyclopropanamin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.