
CAS 900512-29-0
:Azetidine, 3-(2-chloro-4-fluorophenoxy)-, hydrochloride (1:1)
Description:
Azetidine, 3-(2-chloro-4-fluorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the 2-chloro-4-fluorophenoxy group indicates that the compound has a phenoxy moiety substituted with chlorine and fluorine atoms, contributing to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the substituents on the phenoxy group and the azetidine ring. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C9H9ClFNO·ClH
InChI:InChI=1S/C9H9ClFNO.ClH/c10-8-3-6(11)1-2-9(8)13-7-4-12-5-7;/h1-3,7,12H,4-5H2;1H
InChI key:InChIKey=FQLHSSBPQTWCAW-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(F)C=C1)C2CNC2.Cl
Synonyms:- Azetidine, 3-(2-chloro-4-fluorophenoxy)-, hydrochloride
- Azetidine, 3-(2-chloro-4-fluorophenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.