
CAS 90055-97-3
:Tienoxolol
Description:
Tienoxolol, with the CAS number 90055-97-3, is a pharmaceutical compound primarily classified as a beta-adrenergic antagonist, commonly referred to as a beta-blocker. It is utilized in the management of cardiovascular conditions, particularly hypertension and certain types of arrhythmias. The compound exhibits selectivity for beta-1 adrenergic receptors, which are predominantly found in the heart, leading to decreased heart rate and myocardial contractility. Tienoxolol is characterized by its ability to reduce cardiac workload and oxygen demand, making it beneficial in treating conditions such as angina and heart failure. Additionally, it may possess some intrinsic sympathomimetic activity, which can influence its overall pharmacological profile. The substance is typically administered orally and is well-absorbed in the gastrointestinal tract. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are essential for determining dosing regimens and potential interactions with other medications. As with other beta-blockers, common side effects may include fatigue, dizziness, and bradycardia, necessitating careful monitoring in patients.
Formula:C21H28N2O5S
InChI:InChI=1S/C21H28N2O5S/c1-5-27-20(26)16-11-14(23-19(25)18-7-6-10-29-18)8-9-17(16)28-13-15(24)12-22-21(2,3)4/h6-11,15,22,24H,5,12-13H2,1-4H3,(H,23,25)
InChI key:InChIKey=PHMRLCQEIQGCHH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(OCC(CNC(C)(C)C)O)C=CC(NC(=O)C2=CC=CS2)=C1
Synonyms:- Tienoxolol
- Benzoic acid, 2-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]-5-[(2-thienylcarbonyl)amino]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tienoxolol
CAS:Tienoxolol is a molecule diuretic, natriuretic and P-adrenoceptor blocking properties. Furthermore, tienoxolol binds to Al and A2 adenosine receptors.Formula:C21H28N2O5SColor and Shape:SolidMolecular weight:420.52
