CAS 90057-07-1

2-methoxy-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one

Description:

2-Methoxy-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a methoxy group (-OCH3) at the 2-position, contributing to its chemical reactivity and solubility properties. The presence of the dihydro group indicates that the compound has a saturated bond within the bicyclic framework, which can influence its stability and reactivity. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, and the methoxy substitution can enhance lipophilicity, affecting absorption and distribution in biological systems. Additionally, the compound's CAS number, 90057-07-1, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical and pharmaceutical contexts. Overall, 2-methoxy-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one represents a class of compounds with diverse applications in chemistry and biology.

Formula: C₇H₇N₃O₂

InChI: InChI=1/C7H7N3O2/c1-12-7-9-5-4(2-3-8-5)6(11)10-7/h2-3H,1H3,(H2,8,9,10,11)

SMILES: COc1nc2c(cc[nH]2)c(n1)O

6-Hydroxy-2-methoxy-7-deazapurine

CAS: 90057-07-1

Formula: C₇H₇N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.1494

Ref: IN-DA00GWA0

6-Hydroxy-2-methoxy-7-deazapurine

Controlled Product

CAS: 90057-07-1

Applications 6-Hydroxy-2-methoxy-7-deazapurine (cas# 90057-07-1) is a compound useful in organic synthesis.

Formula: C₇H₇N₃O₂

Color and Shape: Neat

Molecular weight: 165.15

Ref: TR-H946325