CAS 900572-37-4

2-(4-Piperidinyloxy)benzonitrile

Description:

2-(4-Piperidinyloxy)benzonitrile, identified by its CAS number 900572-37-4, is a chemical compound characterized by its unique structure, which includes a benzonitrile moiety and a piperidine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the piperidinyloxy group suggests that it may engage in hydrogen bonding and exhibit lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the nitrile functional group may impart specific reactivity and stability characteristics. Compounds of this nature are often investigated for their pharmacological properties, including potential roles as intermediates in drug synthesis or as active pharmaceutical ingredients. The specific interactions and effects of 2-(4-Piperidinyloxy)benzonitrile would depend on its molecular interactions, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1/C12H14N2O/c13-9-10-3-1-2-4-12(10)15-11-5-7-14-8-6-11/h1-4,11,14H,5-8H2

SMILES: c1ccc(c(c1)C#N)OC1CCNCC1

Synonyms:

• 2-(Piperidin-4-Yloxy)Benzonitrile
• Benzonitrile, 2-(4-Piperidinyloxy)-
• 2-(4-Piperidyloxy)Benzonitrile

2-(4-Piperidinyloxy)benzonitrile

CAS: 900572-37-4

Formula: C₁₂H₁₄N₂O

Molecular weight: 202.2524

Ref: IN-DA003EXH