CAS 900572-43-2

(3S)-3-(2-methylphenoxy)pyrrolidine

Description:

(3S)-3-(2-methylphenoxy)pyrrolidine is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing heterocycle. The compound features a 2-methylphenoxy group attached to the third carbon of the pyrrolidine ring, contributing to its unique properties. This substitution can influence the compound's solubility, reactivity, and biological activity. The stereochemistry indicated by the (3S) designation suggests that the compound has a specific spatial arrangement around the chiral center, which can significantly affect its interaction with biological systems, including receptor binding and enzyme activity. Generally, compounds like this may exhibit potential pharmacological properties, making them of interest in medicinal chemistry and drug development. Additionally, the presence of both aromatic and aliphatic components in its structure may enhance its lipophilicity, influencing its absorption and distribution in biological systems. Overall, (3S)-3-(2-methylphenoxy)pyrrolidine represents a class of compounds that could have diverse applications in pharmaceuticals and chemical research.

Formula: C₁₁H₁₅NO

InChI: InChI=1/C11H15NO/c1-9-4-2-3-5-11(9)13-10-6-7-12-8-10/h2-5,10,12H,6-8H2,1H3/t10-/m0/s1

Synonyms:

• pyrrolidine, 3-(2-methylphenoxy)-, (3S)-