CAS 90060-42-7
:6-(methylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diyl bis(2-methylpropanoate)
Description:
6-(Methylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diyl bis(2-methylpropanoate) is an organic compound characterized by its complex structure, which includes a tetrahydronaphthalene core substituted with a methylamino group and two ester functionalities derived from 2-methylpropanoic acid. This compound is likely to exhibit properties typical of esters, such as being relatively non-polar, with potential solubility in organic solvents. The presence of the methylamino group may impart basic characteristics and influence its reactivity, particularly in nucleophilic substitution reactions. Additionally, the bulky 2-methylpropanoate groups can affect the steric hindrance around the reactive sites, potentially impacting its biological activity and interactions with other molecules. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, pH, and the presence of catalysts or other reagents. Overall, this compound may have applications in pharmaceuticals or materials science, although specific uses would require further investigation.
Formula:C19H27NO4
InChI:InChI=1/C19H27NO4/c1-11(2)18(21)23-16-9-6-13-10-14(20-5)7-8-15(13)17(16)24-19(22)12(3)4/h6,9,11-12,14,20H,7-8,10H2,1-5H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nolomirole
CAS:Nolomirole is a dopamine receptor agonist that reduces symptoms of congestive heart failure caused by monoclinine.Formula:C19H27NO4Color and Shape:SolidMolecular weight:333.42
