CAS 900640-45-1

2-(1,1-Dimethylethyl)-7-ethyl-1H-indole

Description:

2-(1,1-Dimethylethyl)-7-ethyl-1H-indole, identified by its CAS number 900640-45-1, is an organic compound belonging to the indole family, which is characterized by a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. This compound features a tert-butyl group (1,1-dimethylethyl) and an ethyl group attached to the indole structure, contributing to its unique properties. Generally, indoles exhibit interesting biological activities and can serve as precursors for various pharmaceuticals and agrochemicals. The presence of bulky substituents like tert-butyl can influence the compound's solubility, stability, and reactivity, potentially enhancing its lipophilicity. Additionally, the compound may exhibit fluorescence, making it useful in certain analytical applications. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 2-(1,1-Dimethylethyl)-7-ethyl-1H-indole represents a structurally interesting compound with potential applications in various fields of chemistry and biology.

Formula: C₁₄H₁₉N

InChI: InChI=1S/C14H19N/c1-5-10-7-6-8-11-9-12(14(2,3)4)15-13(10)11/h6-9,15H,5H2,1-4H3

InChI key: InChIKey=DWZODHPZMHYREZ-UHFFFAOYSA-N

SMILES: C(C)C1=C2C(C=C(C(C)(C)C)N2)=CC=C1

Synonyms:

• 2-(1,1-Dimethylethyl)-7-ethyl-1H-indole
• 1H-Indole, 2-(1,1-dimethylethyl)-7-ethyl-