CAS 900640-50-8

Methyl 4,6,7-trimethyl-1H-indole-2-carboxylate

Description:

Methyl 4,6,7-trimethyl-1H-indole-2-carboxylate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features three methyl groups at the 4, 6, and 7 positions of the indole ring, contributing to its unique chemical properties and potential biological activity. The presence of a carboxylate group (ester) at the 2-position enhances its reactivity and solubility in organic solvents. Methyl esters are often used in various chemical syntheses and can serve as intermediates in the production of pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Additionally, its CAS number, 900640-50-8, allows for easy identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and material science.

Formula: C₁₃H₁₅NO₂

InChI: InChI=1S/C13H15NO2/c1-7-5-8(2)10-6-11(13(15)16-4)14-12(10)9(7)3/h5-6,14H,1-4H3

InChI key: InChIKey=UGEHGELJFQLBBM-UHFFFAOYSA-N

SMILES: CC1=C2C(NC(C(OC)=O)=C2)=C(C)C(C)=C1

Synonyms:

• Methyl 4,6,7-trimethyl-1H-indole-2-carboxylate
• 1H-Indole-2-carboxylic acid, 4,6,7-trimethyl-, methyl ester