
CAS 900640-67-7
:2-[[(1-Methylpropyl)amino]methyl]-4(3H)-quinazolinone
Description:
2-[[(1-Methylpropyl)amino]methyl]-4(3H)-quinazolinone, identified by its CAS number 900640-67-7, is a chemical compound that belongs to the quinazolinone class, which is characterized by a fused bicyclic structure containing both a benzene and a pyrimidine ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the 1-methylpropyl group suggests that it may have lipophilic characteristics, which can influence its pharmacokinetics and interaction with biological targets. Additionally, the amino group in its structure may contribute to its reactivity and ability to form hydrogen bonds, which is crucial for its biological activity. Compounds of this nature are often investigated for their potential therapeutic applications, including roles as enzyme inhibitors or in the modulation of various biological pathways. However, specific details regarding its efficacy, safety, and applications would require further empirical studies and data.
Formula:C13H17N3O
InChI:InChI=1S/C13H17N3O/c1-3-9(2)14-8-12-15-11-7-5-4-6-10(11)13(17)16-12/h4-7,9,14H,3,8H2,1-2H3,(H,15,16,17)
InChI key:InChIKey=KMWYMYWBSRCZJE-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(CNC(CC)C)=N1)=CC=CC2
Synonyms:- 4(3H)-Quinazolinone, 2-[[(1-methylpropyl)amino]methyl]-
- 2-[[(Butan-2-yl)amino]methyl]-3,4-dihydroquinazolin-4-one
- 2-[[(1-Methylpropyl)amino]methyl]-4(3H)-quinazolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.