CAS 900641-11-4

1-(Tetrahydro-1,1-dioxido-3-thienyl)-4-piperidinecarboxylic acid

Description:

1-(Tetrahydro-1,1-dioxido-3-thienyl)-4-piperidinecarboxylic acid, with the CAS number 900641-11-4, is a chemical compound characterized by its unique structural features, including a piperidine ring and a thienyl group. The presence of the tetrahydro-1,1-dioxide moiety contributes to its potential reactivity and solubility properties. This compound is likely to exhibit both acidic and basic characteristics due to the carboxylic acid functional group and the nitrogen atom in the piperidine ring. Its thienyl component may impart specific electronic properties, influencing its interactions in biological systems or chemical reactions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the piperidine and thienyl groups could enhance biological activity or selectivity. However, detailed studies on its pharmacological properties, stability, and synthesis would be necessary to fully understand its potential uses and behavior in various environments.

Formula: C₁₀H₁₇NO₄S

InChI: InChI=1S/C10H17NO4S/c12-10(13)8-1-4-11(5-2-8)9-3-6-16(14,15)7-9/h8-9H,1-7H2,(H,12,13)

InChI key: InChIKey=LZGSJQNRMQTUOM-UHFFFAOYSA-N

SMILES: O=S1(=O)CC(CC1)N2CCC(C(O)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(tetrahydro-1,1-dioxido-3-thienyl)-
• 1-(Tetrahydro-1,1-dioxido-3-thienyl)-4-piperidinecarboxylic acid
• 1-(1,1-Dioxo-1λ6-thiolan-3-yl)piperidine-4-carboxylic acid
• 1-(1,1-Dioxidotetrahydro-3-thienyl)-4-piperidinecarboxylic acid