CAS 900641-17-0

6-Fluoro-3,4-dihydro-2H-1-benzothiopyran-4-amine

Description:

6-Fluoro-3,4-dihydro-2H-1-benzothiopyran-4-amine is a chemical compound characterized by its unique structure, which includes a benzothiopyran core with a fluorine substituent and an amine group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amine functional group, which can participate in hydrogen bonding and interact with biological targets. The fluorine atom may enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, the dihydro form indicates that the compound may exist in a saturated state, which can affect its reactivity and stability. The presence of sulfur in the benzothiopyran ring contributes to its chemical behavior, potentially allowing for various reactions typical of thiophene derivatives. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, specific applications and biological activities would require further investigation through experimental studies.

Formula: C₉H₁₀FNS

InChI: InChI=1S/C9H10FNS/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5,8H,3-4,11H2

InChI key: InChIKey=MMNJIDRWJPJNRL-UHFFFAOYSA-N

SMILES: NC1C=2C(=CC=C(F)C2)SCC1

Synonyms:

• 6-Fluoro-3,4-dihydro-2H-1-benzothiopyran-4-amine
• 2H-1-Benzothiopyran-4-amine, 6-fluoro-3,4-dihydro-