
CAS 900641-38-5
:N-Propyl-5-(2-thienyl)-1,3,4-oxadiazole-2-methanamine
Description:
N-Propyl-5-(2-thienyl)-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring fused with a thienyl group. This compound features a propyl chain and an amine functional group, contributing to its potential reactivity and solubility properties. The oxadiazole moiety is known for its applications in pharmaceuticals and materials science due to its electronic properties and ability to participate in various chemical reactions. The presence of the thienyl group may enhance the compound's biological activity and influence its interaction with biological targets. As a member of the oxadiazole family, this compound may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics or as a fluorescent probe. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Further research is necessary to fully elucidate its properties and potential applications in various fields.
Formula:C10H13N3OS
InChI:InChI=1S/C10H13N3OS/c1-2-5-11-7-9-12-13-10(14-9)8-4-3-6-15-8/h3-4,6,11H,2,5,7H2,1H3
InChI key:InChIKey=XUSFHDRSBSMRSS-UHFFFAOYSA-N
SMILES:C(NCCC)C=1OC(=NN1)C2=CC=CS2
Synonyms:- N-Propyl-5-(2-thienyl)-1,3,4-oxadiazole-2-methanamine
- 1,3,4-Oxadiazole-2-methanamine, N-propyl-5-(2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.