CymitQuimica logo

CAS 900641-46-5

:

4-(Chloromethyl)-2-(4-ethylphenyl)thiazole

Description:
4-(Chloromethyl)-2-(4-ethylphenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a chloromethyl group (-CH2Cl) at the 4-position and a 4-ethylphenyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It may participate in various chemical reactions, including nucleophilic substitutions due to the reactive chloromethyl group. The thiazole moiety is known for its biological activity, making compounds like this of interest in medicinal chemistry and drug development. Additionally, the presence of the ethylphenyl group can influence the compound's lipophilicity and overall reactivity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-(Chloromethyl)-2-(4-ethylphenyl)thiazole is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C12H12ClNS
InChI:InChI=1S/C12H12ClNS/c1-2-9-3-5-10(6-4-9)12-14-11(7-13)8-15-12/h3-6,8H,2,7H2,1H3
InChI key:InChIKey=LGPBFPAIFFOHBF-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(SC1)C2=CC=C(CC)C=C2
Synonyms:
  • 4-(Chloromethyl)-2-(4-ethylphenyl)thiazole
  • Thiazole, 4-(chloromethyl)-2-(4-ethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.