
CAS 90065-72-8
:4-Chloro-7-(methoxymethyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine
Description:
4-Chloro-7-(methoxymethyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrrolo[2,3-d]pyrimidine core. This compound features a chloro substituent at the 4-position and a methoxymethyl group at the 7-position, contributing to its unique reactivity and potential biological activity. The presence of the amino group at the 2-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit antitumor or antiviral properties. Its molecular structure allows for various synthetic modifications, which can be explored to optimize its pharmacological profile. As with many heterocyclic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Proper handling and storage are essential due to its chemical properties and potential biological effects.
Formula:C8H9ClN4O
InChI:InChI=1S/C8H9ClN4O/c1-14-4-13-3-2-5-6(9)11-8(10)12-7(5)13/h2-3H,4H2,1H3,(H2,10,11,12)
InChI key:InChIKey=WEBXQOIHAIDATL-UHFFFAOYSA-N
SMILES:C(OC)N1C=2C(=C(Cl)N=C(N)N2)C=C1
Synonyms:- 7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 4-chloro-7-(methoxymethyl)-
- 4-Chloro-7-(methoxymethyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.